About 1H-perimidine;1H-pyrimidine-2,4-dione
1H-perimidine;1H-pyrimidine-2,4-dione (PubChem CID 174377949) has the molecular formula C15H12N4O2
and a molecular weight of 280.29 g/mol. Its IUPAC name is 1H-perimidine;1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 1H-perimidine;1H-pyrimidine-2,4-dione |
| PubChem CID | 174377949 |
| Molecular Formula | C15H12N4O2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 1H-perimidine;1H-pyrimidine-2,4-dione |
| SMILES | C1=Nc2cccc3cccc(c23)N1.O=c1cc[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C11H8N2.C4H4N2O2/c1-3-8-4-2-6-10-11(8)9(5-1)12-7-13-10;7-3-1-2-5-4(8)6-3/h1-7H,(H,12,13);1-2H,(H2,5,6,7,8) |
| InChIKey | BXTKYLVTCPFEHW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'naphth_amino_A(25)', 'substructure': 'N/A'} |
|---|
Analyze 1H-perimidine;1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-perimidine;1H-pyrimidine-2,4-dione?
The IUPAC name of 1H-perimidine;1H-pyrimidine-2,4-dione (CID 174377949) is 1H-perimidine;1H-pyrimidine-2,4-dione.
What is the SMILES notation for 1H-perimidine;1H-pyrimidine-2,4-dione?
The canonical SMILES for 1H-perimidine;1H-pyrimidine-2,4-dione is C1=Nc2cccc3cccc(c23)N1.O=c1cc[nH]c(=O)[nH]1.
What is the InChIKey of 1H-perimidine;1H-pyrimidine-2,4-dione?
The InChIKey is BXTKYLVTCPFEHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2.C4H4N2O2/c1-3-8-4-2-6-10-11(8)9(5-1)12-7-13-10;7-3-1-2-5-4(8)6-3/h1-7H,(H,12,13);1-2H,(H2,5,6,7,8).
What are the key properties of 1H-perimidine;1H-pyrimidine-2,4-dione?
1H-perimidine;1H-pyrimidine-2,4-dione has a molecular weight of 280.29 g/mol, XLogP of 1.99, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-perimidine;1H-pyrimidine-2,4-dione is sourced from PubChem (CID 174377949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).