About N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;methyl propanoate
N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;methyl propanoate (PubChem CID 174378089) has the molecular formula C20H22ClNO3S
and a molecular weight of 391.92 g/mol. Its IUPAC name is N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;methyl propanoate.
Molecular Properties
| Compound Name | N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;methyl propanoate |
| PubChem CID | 174378089 |
| Molecular Formula | C20H22ClNO3S |
| Molecular Weight | 391.92 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;methyl propanoate |
| SMILES | CCC(=O)OC.COc1ccc(CNc2cccc3sccc23)cc1Cl |
| InChI | InChI=1S/C16H14ClNOS.C4H8O2/c1-19-15-6-5-11(9-13(15)17)10-18-14-3-2-4-16-12(14)7-8-20-16;1-3-4(5)6-2/h2-9,18H,10H2,1H3;3H2,1-2H3 |
| InChIKey | DQURVRIDHPTWEM-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.92 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;methyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;methyl propanoate?
The IUPAC name of N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;methyl propanoate (CID 174378089) is N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;methyl propanoate.
What is the SMILES notation for N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;methyl propanoate?
The canonical SMILES for N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;methyl propanoate is CCC(=O)OC.COc1ccc(CNc2cccc3sccc23)cc1Cl.
What is the InChIKey of N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;methyl propanoate?
The InChIKey is DQURVRIDHPTWEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClNOS.C4H8O2/c1-19-15-6-5-11(9-13(15)17)10-18-14-3-2-4-16-12(14)7-8-20-16;1-3-4(5)6-2/h2-9,18H,10H2,1H3;3H2,1-2H3.
What are the key properties of N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;methyl propanoate?
N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;methyl propanoate has a molecular weight of 391.92 g/mol, XLogP of 5.74, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;methyl propanoate is sourced from PubChem (CID 174378089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).