About N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;propanamide
N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;propanamide (PubChem CID 174378326) has the molecular formula C19H21ClN2O2S
and a molecular weight of 376.91 g/mol. Its IUPAC name is N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;propanamide.
Molecular Properties
| Compound Name | N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;propanamide |
| PubChem CID | 174378326 |
| Molecular Formula | C19H21ClN2O2S |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;propanamide |
| SMILES | CCC(N)=O.COc1ccc(CNc2cccc3sccc23)cc1Cl |
| InChI | InChI=1S/C16H14ClNOS.C3H7NO/c1-19-15-6-5-11(9-13(15)17)10-18-14-3-2-4-16-12(14)7-8-20-16;1-2-3(4)5/h2-9,18H,10H2,1H3;2H2,1H3,(H2,4,5) |
| InChIKey | MSCCDIBNHKMGFT-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;propanamide?
The IUPAC name of N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;propanamide (CID 174378326) is N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;propanamide.
What is the SMILES notation for N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;propanamide?
The canonical SMILES for N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;propanamide is CCC(N)=O.COc1ccc(CNc2cccc3sccc23)cc1Cl.
What is the InChIKey of N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;propanamide?
The InChIKey is MSCCDIBNHKMGFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClNOS.C3H7NO/c1-19-15-6-5-11(9-13(15)17)10-18-14-3-2-4-16-12(14)7-8-20-16;1-2-3(4)5/h2-9,18H,10H2,1H3;2H2,1H3,(H2,4,5).
What are the key properties of N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;propanamide?
N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;propanamide has a molecular weight of 376.91 g/mol, XLogP of 5.06, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-chloro-4-methoxyphenyl)methyl]-1-benzothiophen-4-amine;propanamide is sourced from PubChem (CID 174378326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).