C16H35NO3Si — CID 174378342
2-methylazetidine;1,1,2-trimethoxy-2-methyl-3-propylsilinane (PubChem CID 174378342) has the molecular formula C16H35NO3Si and a molecular weight of 317.55 g/mol. Its IUPAC name is 2-methylazetidine;1,1,2-trimethoxy-2-methyl-3-propylsilinane.
| Compound Name | 2-methylazetidine;1,1,2-trimethoxy-2-methyl-3-propylsilinane |
|---|---|
| PubChem CID | 174378342 |
| Molecular Formula | C16H35NO3Si |
| Molecular Weight | 317.55 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | 2-methylazetidine;1,1,2-trimethoxy-2-methyl-3-propylsilinane |
| SMILES | CC1CCN1.CCCC1CCC[Si](OC)(OC)C1(C)OC |
| InChI | InChI=1S/C12H26O3Si.C4H9N/c1-6-8-11-9-7-10-16(14-4,15-5)12(11,2)13-3;1-4-2-3-5-4/h11H,6-10H2,1-5H3;4-5H,2-3H2,1H3 |
| InChIKey | AOIVLKCGQYAUGN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.55 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|