C25H27FN4O — CID 174378498
N-[6-[4-(6-amino-2-pyridinyl)phenyl]-4-iminohexan-2-yl]-2-(4-fluorophenyl)acetamide (PubChem CID 174378498) has the molecular formula C25H27FN4O and a molecular weight of 418.52 g/mol. Its IUPAC name is N-[6-[4-(6-amino-2-pyridinyl)phenyl]-4-iminohexan-2-yl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[6-[4-(6-amino-2-pyridinyl)phenyl]-4-iminohexan-2-yl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 174378498 |
| Molecular Formula | C25H27FN4O |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | N-[6-[4-(6-amino-2-pyridinyl)phenyl]-4-iminohexan-2-yl]-2-(4-fluorophenyl)acetamide |
| SMILES | [H]/N=C(/CCc1ccc(-c2cccc(N)n2)cc1)CC(C)NC(=O)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C25H27FN4O/c1-17(29-25(31)16-19-7-12-21(26)13-8-19)15-22(27)14-9-18-5-10-20(11-6-18)23-3-2-4-24(28)30-23/h2-8,10-13,17,27H,9,14-16H2,1H3,(H2,28,30)(H,29,31)/b27-22- |
| InChIKey | LGHBBEMHTRCFKJ-QYQHSDTDSA-N |
| XLogP | 4.56 |
| TPSA | 91.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|