C23H16BrFN2O3S — CID 174378593
[4-[1-(3-bromophenyl)-5-(4-fluorophenyl)-6-oxopyridazin-4-yl]phenyl]methanesulfinic acid (PubChem CID 174378593) has the molecular formula C23H16BrFN2O3S and a molecular weight of 499.36 g/mol. Its IUPAC name is [4-[1-(3-bromophenyl)-5-(4-fluorophenyl)-6-oxopyridazin-4-yl]phenyl]methanesulfinic acid.
| Compound Name | [4-[1-(3-bromophenyl)-5-(4-fluorophenyl)-6-oxopyridazin-4-yl]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 174378593 |
| Molecular Formula | C23H16BrFN2O3S |
| Molecular Weight | 499.36 g/mol |
| Exact Mass | 498.00 |
| IUPAC Name | [4-[1-(3-bromophenyl)-5-(4-fluorophenyl)-6-oxopyridazin-4-yl]phenyl]methanesulfinic acid |
| SMILES | O=c1c(-c2ccc(F)cc2)c(-c2ccc(CS(=O)O)cc2)cnn1-c1cccc(Br)c1 |
| InChI | InChI=1S/C23H16BrFN2O3S/c24-18-2-1-3-20(12-18)27-23(28)22(17-8-10-19(25)11-9-17)21(13-26-27)16-6-4-15(5-7-16)14-31(29)30/h1-13H,14H2,(H,29,30) |
| InChIKey | ZOGQLYQRGLLSPH-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.36 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|