C9H12F3N — CID 174379181
1,1,1-trifluoro-N-[(2Z,4Z)-hexa-2,4-dien-2-yl]propan-2-imine (PubChem CID 174379181) has the molecular formula C9H12F3N and a molecular weight of 191.20 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[(2Z,4Z)-hexa-2,4-dien-2-yl]propan-2-imine.
| Compound Name | 1,1,1-trifluoro-N-[(2Z,4Z)-hexa-2,4-dien-2-yl]propan-2-imine |
|---|---|
| PubChem CID | 174379181 |
| Molecular Formula | C9H12F3N |
| Molecular Weight | 191.20 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 1,1,1-trifluoro-N-[(2Z,4Z)-hexa-2,4-dien-2-yl]propan-2-imine |
| SMILES | C/C=C\C=C(C)/N=C(\C)C(F)(F)F |
| InChI | InChI=1S/C9H12F3N/c1-4-5-6-7(2)13-8(3)9(10,11)12/h4-6H,1-3H3/b5-4-,7-6-,13-8+ |
| InChIKey | YVRJWBTTZWCQSU-NURWVTDCSA-N |
| XLogP | 3.49 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.20 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|