About 5H-tetrazole-5-sulfinate
5H-tetrazole-5-sulfinate (PubChem CID 174379657) has the molecular formula CHN4O2S-
and a molecular weight of 133.11 g/mol. Its IUPAC name is 5H-tetrazole-5-sulfinate.
Molecular Properties
| Compound Name | 5H-tetrazole-5-sulfinate |
| PubChem CID | 174379657 |
| Molecular Formula | CHN4O2S- |
| Molecular Weight | 133.11 g/mol |
| Exact Mass | 132.98 |
| IUPAC Name | 5H-tetrazole-5-sulfinate |
| SMILES | O=S([O-])C1N=NN=N1 |
| InChI | InChI=1S/CH2N4O2S/c6-8(7)1-2-4-5-3-1/h1H,(H,6,7)/p-1 |
| InChIKey | KHAWTHCWAUIJHU-UHFFFAOYSA-M |
| XLogP | -0.02 |
| TPSA | 89.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.11 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 5H-tetrazole-5-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5H-tetrazole-5-sulfinate?
The IUPAC name of 5H-tetrazole-5-sulfinate (CID 174379657) is 5H-tetrazole-5-sulfinate.
What is the SMILES notation for 5H-tetrazole-5-sulfinate?
The canonical SMILES for 5H-tetrazole-5-sulfinate is O=S([O-])C1N=NN=N1.
What is the InChIKey of 5H-tetrazole-5-sulfinate?
The InChIKey is KHAWTHCWAUIJHU-UHFFFAOYSA-M. The full InChI is InChI=1S/CH2N4O2S/c6-8(7)1-2-4-5-3-1/h1H,(H,6,7)/p-1.
What are the key properties of 5H-tetrazole-5-sulfinate?
5H-tetrazole-5-sulfinate has a molecular weight of 133.11 g/mol, XLogP of -0.02, 1 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5H-tetrazole-5-sulfinate is sourced from PubChem (CID 174379657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).