About 1-(2-hydroxyethyl)-3,3,4-tris(methylamino)indol-2-one
1-(2-hydroxyethyl)-3,3,4-tris(methylamino)indol-2-one (PubChem CID 174379879) has the molecular formula C13H20N4O2
and a molecular weight of 264.33 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3,3,4-tris(methylamino)indol-2-one.
Molecular Properties
| Compound Name | 1-(2-hydroxyethyl)-3,3,4-tris(methylamino)indol-2-one |
| PubChem CID | 174379879 |
| Molecular Formula | C13H20N4O2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | 1-(2-hydroxyethyl)-3,3,4-tris(methylamino)indol-2-one |
| SMILES | CNc1cccc2c1C(NC)(NC)C(=O)N2CCO |
| InChI | InChI=1S/C13H20N4O2/c1-14-9-5-4-6-10-11(9)13(15-2,16-3)12(19)17(10)7-8-18/h4-6,14-16,18H,7-8H2,1-3H3 |
| InChIKey | YFYSEYNFIRNVTR-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-hydroxyethyl)-3,3,4-tris(methylamino)indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-hydroxyethyl)-3,3,4-tris(methylamino)indol-2-one?
The IUPAC name of 1-(2-hydroxyethyl)-3,3,4-tris(methylamino)indol-2-one (CID 174379879) is 1-(2-hydroxyethyl)-3,3,4-tris(methylamino)indol-2-one.
What is the SMILES notation for 1-(2-hydroxyethyl)-3,3,4-tris(methylamino)indol-2-one?
The canonical SMILES for 1-(2-hydroxyethyl)-3,3,4-tris(methylamino)indol-2-one is CNc1cccc2c1C(NC)(NC)C(=O)N2CCO.
What is the InChIKey of 1-(2-hydroxyethyl)-3,3,4-tris(methylamino)indol-2-one?
The InChIKey is YFYSEYNFIRNVTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N4O2/c1-14-9-5-4-6-10-11(9)13(15-2,16-3)12(19)17(10)7-8-18/h4-6,14-16,18H,7-8H2,1-3H3.
What are the key properties of 1-(2-hydroxyethyl)-3,3,4-tris(methylamino)indol-2-one?
1-(2-hydroxyethyl)-3,3,4-tris(methylamino)indol-2-one has a molecular weight of 264.33 g/mol, XLogP of -0.34, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-hydroxyethyl)-3,3,4-tris(methylamino)indol-2-one is sourced from PubChem (CID 174379879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).