About bicyclo[3.1.0]hexa-1(6),2,4-triene;3-(4-methoxyphenyl)sulfanylpropyl propanoate
bicyclo[3.1.0]hexa-1(6),2,4-triene;3-(4-methoxyphenyl)sulfanylpropyl propanoate (PubChem CID 174379997) has the molecular formula C19H22O3S
and a molecular weight of 330.45 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1(6),2,4-triene;3-(4-methoxyphenyl)sulfanylpropyl propanoate.
Molecular Properties
| Compound Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;3-(4-methoxyphenyl)sulfanylpropyl propanoate |
| PubChem CID | 174379997 |
| Molecular Formula | C19H22O3S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | bicyclo[3.1.0]hexa-1(6),2,4-triene;3-(4-methoxyphenyl)sulfanylpropyl propanoate |
| SMILES | CCC(=O)OCCCSc1ccc(OC)cc1.c1cc2cc-2c1 |
| InChI | InChI=1S/C13H18O3S.C6H4/c1-3-13(14)16-9-4-10-17-12-7-5-11(15-2)6-8-12;1-2-5-4-6(5)3-1/h5-8H,3-4,9-10H2,1-2H3;1-4H |
| InChIKey | WQCGBZSKUORJSH-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[3.1.0]hexa-1(6),2,4-triene;3-(4-methoxyphenyl)sulfanylpropyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[3.1.0]hexa-1(6),2,4-triene;3-(4-methoxyphenyl)sulfanylpropyl propanoate?
The IUPAC name of bicyclo[3.1.0]hexa-1(6),2,4-triene;3-(4-methoxyphenyl)sulfanylpropyl propanoate (CID 174379997) is bicyclo[3.1.0]hexa-1(6),2,4-triene;3-(4-methoxyphenyl)sulfanylpropyl propanoate.
What is the SMILES notation for bicyclo[3.1.0]hexa-1(6),2,4-triene;3-(4-methoxyphenyl)sulfanylpropyl propanoate?
The canonical SMILES for bicyclo[3.1.0]hexa-1(6),2,4-triene;3-(4-methoxyphenyl)sulfanylpropyl propanoate is CCC(=O)OCCCSc1ccc(OC)cc1.c1cc2cc-2c1.
What is the InChIKey of bicyclo[3.1.0]hexa-1(6),2,4-triene;3-(4-methoxyphenyl)sulfanylpropyl propanoate?
The InChIKey is WQCGBZSKUORJSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O3S.C6H4/c1-3-13(14)16-9-4-10-17-12-7-5-11(15-2)6-8-12;1-2-5-4-6(5)3-1/h5-8H,3-4,9-10H2,1-2H3;1-4H.
What are the key properties of bicyclo[3.1.0]hexa-1(6),2,4-triene;3-(4-methoxyphenyl)sulfanylpropyl propanoate?
bicyclo[3.1.0]hexa-1(6),2,4-triene;3-(4-methoxyphenyl)sulfanylpropyl propanoate has a molecular weight of 330.45 g/mol, XLogP of 4.80, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[3.1.0]hexa-1(6),2,4-triene;3-(4-methoxyphenyl)sulfanylpropyl propanoate is sourced from PubChem (CID 174379997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).