About CID 174380290
CID 174380290 (PubChem CID 174380290) has the molecular formula C8H9BNO2
and a molecular weight of 161.98 g/mol.
Molecular Properties
| Compound Name | CID 174380290 |
| PubChem CID | 174380290 |
| Molecular Formula | C8H9BNO2 |
| Molecular Weight | 161.98 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | — |
| SMILES | COC(=O)N[B]c1ccccc1 |
| InChI | InChI=1S/C8H9BNO2/c1-12-8(11)10-9-7-5-3-2-4-6-7/h2-6H,1H3,(H,10,11) |
| InChIKey | NSDSDBPLDXAYES-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.98 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 174380290 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174380290?
The IUPAC name of CID 174380290 (CID 174380290) is not available.
What is the SMILES notation for CID 174380290?
The canonical SMILES for CID 174380290 is COC(=O)N[B]c1ccccc1.
What is the InChIKey of CID 174380290?
The InChIKey is NSDSDBPLDXAYES-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BNO2/c1-12-8(11)10-9-7-5-3-2-4-6-7/h2-6H,1H3,(H,10,11).
What are the key properties of CID 174380290?
CID 174380290 has a molecular weight of 161.98 g/mol, XLogP of 0.29, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174380290 is sourced from PubChem (CID 174380290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).