About 3-cyclopenta-2,4-dien-1-yloxycarbonyl-2-methylbenzoic acid;hafnium
3-cyclopenta-2,4-dien-1-yloxycarbonyl-2-methylbenzoic acid;hafnium (PubChem CID 174380308) has the molecular formula C14H12HfO4
and a molecular weight of 422.74 g/mol. Its IUPAC name is 3-cyclopenta-2,4-dien-1-yloxycarbonyl-2-methylbenzoic acid;hafnium.
Molecular Properties
| Compound Name | 3-cyclopenta-2,4-dien-1-yloxycarbonyl-2-methylbenzoic acid;hafnium |
| PubChem CID | 174380308 |
| Molecular Formula | C14H12HfO4 |
| Molecular Weight | 422.74 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | 3-cyclopenta-2,4-dien-1-yloxycarbonyl-2-methylbenzoic acid;hafnium |
| SMILES | Cc1c(C(=O)O)cccc1C(=O)OC1C=CC=C1.[Hf] |
| InChI | InChI=1S/C14H12O4.Hf/c1-9-11(13(15)16)7-4-8-12(9)14(17)18-10-5-2-3-6-10;/h2-8,10H,1H3,(H,15,16); |
| InChIKey | ZNBPFPNZYJBLKW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.74 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclopenta-2,4-dien-1-yloxycarbonyl-2-methylbenzoic acid;hafnium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopenta-2,4-dien-1-yloxycarbonyl-2-methylbenzoic acid;hafnium?
The IUPAC name of 3-cyclopenta-2,4-dien-1-yloxycarbonyl-2-methylbenzoic acid;hafnium (CID 174380308) is 3-cyclopenta-2,4-dien-1-yloxycarbonyl-2-methylbenzoic acid;hafnium.
What is the SMILES notation for 3-cyclopenta-2,4-dien-1-yloxycarbonyl-2-methylbenzoic acid;hafnium?
The canonical SMILES for 3-cyclopenta-2,4-dien-1-yloxycarbonyl-2-methylbenzoic acid;hafnium is Cc1c(C(=O)O)cccc1C(=O)OC1C=CC=C1.[Hf].
What is the InChIKey of 3-cyclopenta-2,4-dien-1-yloxycarbonyl-2-methylbenzoic acid;hafnium?
The InChIKey is ZNBPFPNZYJBLKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O4.Hf/c1-9-11(13(15)16)7-4-8-12(9)14(17)18-10-5-2-3-6-10;/h2-8,10H,1H3,(H,15,16);.
What are the key properties of 3-cyclopenta-2,4-dien-1-yloxycarbonyl-2-methylbenzoic acid;hafnium?
3-cyclopenta-2,4-dien-1-yloxycarbonyl-2-methylbenzoic acid;hafnium has a molecular weight of 422.74 g/mol, XLogP of 2.34, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopenta-2,4-dien-1-yloxycarbonyl-2-methylbenzoic acid;hafnium is sourced from PubChem (CID 174380308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).