C29H30 — CID 174381909
2,2,11,11-tetramethyl-7-(4-methylphenyl)-1,12-dihydrochrysene (PubChem CID 174381909) has the molecular formula C29H30 and a molecular weight of 378.56 g/mol. Its IUPAC name is 2,2,11,11-tetramethyl-7-(4-methylphenyl)-1,12-dihydrochrysene.
| Compound Name | 2,2,11,11-tetramethyl-7-(4-methylphenyl)-1,12-dihydrochrysene |
|---|---|
| PubChem CID | 174381909 |
| Molecular Formula | C29H30 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 2,2,11,11-tetramethyl-7-(4-methylphenyl)-1,12-dihydrochrysene |
| SMILES | Cc1ccc(-c2cccc3c4c(ccc23)C2=C(CC(C)(C)C=C2)CC4(C)C)cc1 |
| InChI | InChI=1S/C29H30/c1-19-9-11-20(12-10-19)22-7-6-8-25-24(22)13-14-26-23-15-16-28(2,3)17-21(23)18-29(4,5)27(25)26/h6-16H,17-18H2,1-5H3 |
| InChIKey | DBDACEAZJTWGMS-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |