About 6-amino-1H-pyrimidine-2,4-dione;cyclopropane
6-amino-1H-pyrimidine-2,4-dione;cyclopropane (PubChem CID 174382000) has the molecular formula C7H11N3O2
and a molecular weight of 169.18 g/mol. Its IUPAC name is 6-amino-1H-pyrimidine-2,4-dione;cyclopropane.
Molecular Properties
| Compound Name | 6-amino-1H-pyrimidine-2,4-dione;cyclopropane |
| PubChem CID | 174382000 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 6-amino-1H-pyrimidine-2,4-dione;cyclopropane |
| SMILES | C1CC1.Nc1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C4H5N3O2.C3H6/c5-2-1-3(8)7-4(9)6-2;1-2-3-1/h1H,(H4,5,6,7,8,9);1-3H2 |
| InChIKey | AYYCHHBMGKYWMR-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-amino-1H-pyrimidine-2,4-dione;cyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-1H-pyrimidine-2,4-dione;cyclopropane?
The IUPAC name of 6-amino-1H-pyrimidine-2,4-dione;cyclopropane (CID 174382000) is 6-amino-1H-pyrimidine-2,4-dione;cyclopropane.
What is the SMILES notation for 6-amino-1H-pyrimidine-2,4-dione;cyclopropane?
The canonical SMILES for 6-amino-1H-pyrimidine-2,4-dione;cyclopropane is C1CC1.Nc1cc(=O)[nH]c(=O)[nH]1.
What is the InChIKey of 6-amino-1H-pyrimidine-2,4-dione;cyclopropane?
The InChIKey is AYYCHHBMGKYWMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N3O2.C3H6/c5-2-1-3(8)7-4(9)6-2;1-2-3-1/h1H,(H4,5,6,7,8,9);1-3H2.
What are the key properties of 6-amino-1H-pyrimidine-2,4-dione;cyclopropane?
6-amino-1H-pyrimidine-2,4-dione;cyclopropane has a molecular weight of 169.18 g/mol, XLogP of -0.18, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-1H-pyrimidine-2,4-dione;cyclopropane is sourced from PubChem (CID 174382000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).