About 4-cyclopropyl-2-methyl-1-benzofuran;methanamine
4-cyclopropyl-2-methyl-1-benzofuran;methanamine (PubChem CID 174382273) has the molecular formula C13H17NO
and a molecular weight of 203.28 g/mol. Its IUPAC name is 4-cyclopropyl-2-methyl-1-benzofuran;methanamine.
Molecular Properties
| Compound Name | 4-cyclopropyl-2-methyl-1-benzofuran;methanamine |
| PubChem CID | 174382273 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 4-cyclopropyl-2-methyl-1-benzofuran;methanamine |
| SMILES | CN.Cc1cc2c(C3CC3)cccc2o1 |
| InChI | InChI=1S/C12H12O.CH5N/c1-8-7-11-10(9-5-6-9)3-2-4-12(11)13-8;1-2/h2-4,7,9H,5-6H2,1H3;2H2,1H3 |
| InChIKey | HMQNUBLHYQMPLF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-cyclopropyl-2-methyl-1-benzofuran;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyl-2-methyl-1-benzofuran;methanamine?
The IUPAC name of 4-cyclopropyl-2-methyl-1-benzofuran;methanamine (CID 174382273) is 4-cyclopropyl-2-methyl-1-benzofuran;methanamine.
What is the SMILES notation for 4-cyclopropyl-2-methyl-1-benzofuran;methanamine?
The canonical SMILES for 4-cyclopropyl-2-methyl-1-benzofuran;methanamine is CN.Cc1cc2c(C3CC3)cccc2o1.
What is the InChIKey of 4-cyclopropyl-2-methyl-1-benzofuran;methanamine?
The InChIKey is HMQNUBLHYQMPLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O.CH5N/c1-8-7-11-10(9-5-6-9)3-2-4-12(11)13-8;1-2/h2-4,7,9H,5-6H2,1H3;2H2,1H3.
What are the key properties of 4-cyclopropyl-2-methyl-1-benzofuran;methanamine?
4-cyclopropyl-2-methyl-1-benzofuran;methanamine has a molecular weight of 203.28 g/mol, XLogP of 3.19, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-2-methyl-1-benzofuran;methanamine is sourced from PubChem (CID 174382273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).