About 1,3-thiazol-5-yl 2-oxobutanoate
1,3-thiazol-5-yl 2-oxobutanoate (PubChem CID 174382853) has the molecular formula C7H7NO3S
and a molecular weight of 185.20 g/mol. Its IUPAC name is 1,3-thiazol-5-yl 2-oxobutanoate.
Molecular Properties
| Compound Name | 1,3-thiazol-5-yl 2-oxobutanoate |
| PubChem CID | 174382853 |
| Molecular Formula | C7H7NO3S |
| Molecular Weight | 185.20 g/mol |
| Exact Mass | 185.01 |
| IUPAC Name | 1,3-thiazol-5-yl 2-oxobutanoate |
| SMILES | CCC(=O)C(=O)Oc1cncs1 |
| InChI | InChI=1S/C7H7NO3S/c1-2-5(9)7(10)11-6-3-8-4-12-6/h3-4H,2H2,1H3 |
| InChIKey | APTNPKUBWRDEEB-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.20 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1,3-thiazol-5-yl 2-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-thiazol-5-yl 2-oxobutanoate?
The IUPAC name of 1,3-thiazol-5-yl 2-oxobutanoate (CID 174382853) is 1,3-thiazol-5-yl 2-oxobutanoate.
What is the SMILES notation for 1,3-thiazol-5-yl 2-oxobutanoate?
The canonical SMILES for 1,3-thiazol-5-yl 2-oxobutanoate is CCC(=O)C(=O)Oc1cncs1.
What is the InChIKey of 1,3-thiazol-5-yl 2-oxobutanoate?
The InChIKey is APTNPKUBWRDEEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO3S/c1-2-5(9)7(10)11-6-3-8-4-12-6/h3-4H,2H2,1H3.
What are the key properties of 1,3-thiazol-5-yl 2-oxobutanoate?
1,3-thiazol-5-yl 2-oxobutanoate has a molecular weight of 185.20 g/mol, XLogP of 1.03, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-thiazol-5-yl 2-oxobutanoate is sourced from PubChem (CID 174382853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).