About N-(2,4-difluorobenzene-3-id-1-yl)-N-ethyl-2-methylpropanamide;titanium
N-(2,4-difluorobenzene-3-id-1-yl)-N-ethyl-2-methylpropanamide;titanium (PubChem CID 174382923) has the molecular formula C12H14F2NOTi-
and a molecular weight of 274.11 g/mol. Its IUPAC name is N-(2,4-difluorobenzene-3-id-1-yl)-N-ethyl-2-methylpropanamide;titanium.
Molecular Properties
| Compound Name | N-(2,4-difluorobenzene-3-id-1-yl)-N-ethyl-2-methylpropanamide;titanium |
| PubChem CID | 174382923 |
| Molecular Formula | C12H14F2NOTi- |
| Molecular Weight | 274.11 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | N-(2,4-difluorobenzene-3-id-1-yl)-N-ethyl-2-methylpropanamide;titanium |
| SMILES | CCN(C(=O)C(C)C)c1ccc(F)[c-]c1F.[Ti] |
| InChI | InChI=1S/C12H14F2NO.Ti/c1-4-15(12(16)8(2)3)11-6-5-9(13)7-10(11)14;/h5-6,8H,4H2,1-3H3;/q-1; |
| InChIKey | UKLCMLUJZKFXGQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.11 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze N-(2,4-difluorobenzene-3-id-1-yl)-N-ethyl-2-methylpropanamide;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,4-difluorobenzene-3-id-1-yl)-N-ethyl-2-methylpropanamide;titanium?
The IUPAC name of N-(2,4-difluorobenzene-3-id-1-yl)-N-ethyl-2-methylpropanamide;titanium (CID 174382923) is N-(2,4-difluorobenzene-3-id-1-yl)-N-ethyl-2-methylpropanamide;titanium.
What is the SMILES notation for N-(2,4-difluorobenzene-3-id-1-yl)-N-ethyl-2-methylpropanamide;titanium?
The canonical SMILES for N-(2,4-difluorobenzene-3-id-1-yl)-N-ethyl-2-methylpropanamide;titanium is CCN(C(=O)C(C)C)c1ccc(F)[c-]c1F.[Ti].
What is the InChIKey of N-(2,4-difluorobenzene-3-id-1-yl)-N-ethyl-2-methylpropanamide;titanium?
The InChIKey is UKLCMLUJZKFXGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F2NO.Ti/c1-4-15(12(16)8(2)3)11-6-5-9(13)7-10(11)14;/h5-6,8H,4H2,1-3H3;/q-1;.
What are the key properties of N-(2,4-difluorobenzene-3-id-1-yl)-N-ethyl-2-methylpropanamide;titanium?
N-(2,4-difluorobenzene-3-id-1-yl)-N-ethyl-2-methylpropanamide;titanium has a molecular weight of 274.11 g/mol, XLogP of 2.77, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,4-difluorobenzene-3-id-1-yl)-N-ethyl-2-methylpropanamide;titanium is sourced from PubChem (CID 174382923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).