C7H6F2O2STi — CID 174383433
2,4-difluoro-1-methylsulfonylbenzene;titanium (PubChem CID 174383433) has the molecular formula C7H6F2O2STi and a molecular weight of 240.05 g/mol. Its IUPAC name is 2,4-difluoro-1-methylsulfonylbenzene;titanium.
| Compound Name | 2,4-difluoro-1-methylsulfonylbenzene;titanium |
|---|---|
| PubChem CID | 174383433 |
| Molecular Formula | C7H6F2O2STi |
| Molecular Weight | 240.05 g/mol |
| Exact Mass | 239.95 |
| IUPAC Name | 2,4-difluoro-1-methylsulfonylbenzene;titanium |
| SMILES | CS(=O)(=O)c1ccc(F)cc1F.[Ti] |
| InChI | InChI=1S/C7H6F2O2S.Ti/c1-12(10,11)7-3-2-5(8)4-6(7)9;/h2-4H,1H3; |
| InChIKey | QNKDYIALBIIUKV-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.05 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |