C16H13ClF2NOTi- — CID 174383702
4-chloro-N-(2,4-difluorobenzene-3-id-1-yl)-N-propan-2-ylbenzamide;titanium (PubChem CID 174383702) has the molecular formula C16H13ClF2NOTi- and a molecular weight of 356.60 g/mol. Its IUPAC name is 4-chloro-N-(2,4-difluorobenzene-3-id-1-yl)-N-propan-2-ylbenzamide;titanium.
| Compound Name | 4-chloro-N-(2,4-difluorobenzene-3-id-1-yl)-N-propan-2-ylbenzamide;titanium |
|---|---|
| PubChem CID | 174383702 |
| Molecular Formula | C16H13ClF2NOTi- |
| Molecular Weight | 356.60 g/mol |
| Exact Mass | 356.01 |
| IUPAC Name | 4-chloro-N-(2,4-difluorobenzene-3-id-1-yl)-N-propan-2-ylbenzamide;titanium |
| SMILES | CC(C)N(C(=O)c1ccc(Cl)cc1)c1ccc(F)[c-]c1F.[Ti] |
| InChI | InChI=1S/C16H13ClF2NO.Ti/c1-10(2)20(15-8-7-13(18)9-14(15)19)16(21)11-3-5-12(17)6-4-11;/h3-8,10H,1-2H3;/q-1; |
| InChIKey | AMEUXJVKYBOLNV-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.60 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|