C17H16N2OS2 — CID 17438384
2-quinolin-2-ylsulfanyl-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 17438384) has the molecular formula C17H16N2OS2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 2-quinolin-2-ylsulfanyl-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | 2-quinolin-2-ylsulfanyl-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 17438384 |
| Molecular Formula | C17H16N2OS2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 2-quinolin-2-ylsulfanyl-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | CC(Sc1ccc2ccccc2n1)C(=O)NCc1cccs1 |
| InChI | InChI=1S/C17H16N2OS2/c1-12(17(20)18-11-14-6-4-10-21-14)22-16-9-8-13-5-2-3-7-15(13)19-16/h2-10,12H,11H2,1H3,(H,18,20) |
| InChIKey | CIYOMJPGZLYEKT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |