About [4-[3-(4-aminophenyl)-5,5-dimethyl-4-oxofuran-2-yl]-2-fluorophenyl]methanesulfinate
[4-[3-(4-aminophenyl)-5,5-dimethyl-4-oxofuran-2-yl]-2-fluorophenyl]methanesulfinate (PubChem CID 174384620) has the molecular formula C19H17FNO4S-
and a molecular weight of 374.41 g/mol. Its IUPAC name is [4-[3-(4-aminophenyl)-5,5-dimethyl-4-oxofuran-2-yl]-2-fluorophenyl]methanesulfinate.
Molecular Properties
| Compound Name | [4-[3-(4-aminophenyl)-5,5-dimethyl-4-oxofuran-2-yl]-2-fluorophenyl]methanesulfinate |
| PubChem CID | 174384620 |
| Molecular Formula | C19H17FNO4S- |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | [4-[3-(4-aminophenyl)-5,5-dimethyl-4-oxofuran-2-yl]-2-fluorophenyl]methanesulfinate |
| SMILES | CC1(C)OC(c2ccc(CS(=O)[O-])c(F)c2)=C(c2ccc(N)cc2)C1=O |
| InChI | InChI=1S/C19H18FNO4S/c1-19(2)18(22)16(11-5-7-14(21)8-6-11)17(25-19)12-3-4-13(10-26(23)24)15(20)9-12/h3-9H,10,21H2,1-2H3,(H,23,24)/p-1 |
| InChIKey | QFCXLKDQQODNGA-UHFFFAOYSA-M |
| XLogP | 3.03 |
| TPSA | 92.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze [4-[3-(4-aminophenyl)-5,5-dimethyl-4-oxofuran-2-yl]-2-fluorophenyl]methanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3-(4-aminophenyl)-5,5-dimethyl-4-oxofuran-2-yl]-2-fluorophenyl]methanesulfinate?
The IUPAC name of [4-[3-(4-aminophenyl)-5,5-dimethyl-4-oxofuran-2-yl]-2-fluorophenyl]methanesulfinate (CID 174384620) is [4-[3-(4-aminophenyl)-5,5-dimethyl-4-oxofuran-2-yl]-2-fluorophenyl]methanesulfinate.
What is the SMILES notation for [4-[3-(4-aminophenyl)-5,5-dimethyl-4-oxofuran-2-yl]-2-fluorophenyl]methanesulfinate?
The canonical SMILES for [4-[3-(4-aminophenyl)-5,5-dimethyl-4-oxofuran-2-yl]-2-fluorophenyl]methanesulfinate is CC1(C)OC(c2ccc(CS(=O)[O-])c(F)c2)=C(c2ccc(N)cc2)C1=O.
What is the InChIKey of [4-[3-(4-aminophenyl)-5,5-dimethyl-4-oxofuran-2-yl]-2-fluorophenyl]methanesulfinate?
The InChIKey is QFCXLKDQQODNGA-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H18FNO4S/c1-19(2)18(22)16(11-5-7-14(21)8-6-11)17(25-19)12-3-4-13(10-26(23)24)15(20)9-12/h3-9H,10,21H2,1-2H3,(H,23,24)/p-1.
What are the key properties of [4-[3-(4-aminophenyl)-5,5-dimethyl-4-oxofuran-2-yl]-2-fluorophenyl]methanesulfinate?
[4-[3-(4-aminophenyl)-5,5-dimethyl-4-oxofuran-2-yl]-2-fluorophenyl]methanesulfinate has a molecular weight of 374.41 g/mol, XLogP of 3.03, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3-(4-aminophenyl)-5,5-dimethyl-4-oxofuran-2-yl]-2-fluorophenyl]methanesulfinate is sourced from PubChem (CID 174384620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).