C9H11NaO4 — CID 174385206
sodium 6-methoxy-2,5-dimethyl-6-oxohexa-2,4-dienoate (PubChem CID 174385206) has the molecular formula C9H11NaO4 and a molecular weight of 206.17 g/mol. Its IUPAC name is sodium 6-methoxy-2,5-dimethyl-6-oxohexa-2,4-dienoate.
| Compound Name | sodium 6-methoxy-2,5-dimethyl-6-oxohexa-2,4-dienoate |
|---|---|
| PubChem CID | 174385206 |
| Molecular Formula | C9H11NaO4 |
| Molecular Weight | 206.17 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | sodium 6-methoxy-2,5-dimethyl-6-oxohexa-2,4-dienoate |
| SMILES | COC(=O)C(C)=CC=C(C)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C9H12O4.Na/c1-6(8(10)11)4-5-7(2)9(12)13-3;/h4-5H,1-3H3,(H,10,11);/q;+1/p-1 |
| InChIKey | YSYRDDJPAVBRGO-UHFFFAOYSA-M |
| XLogP | -3.19 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.17 |
| LogP ≤ 5 | -3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|