About ethenesulfinate;1-fluoro-4-[(E)-2-phenylethenyl]benzene
ethenesulfinate;1-fluoro-4-[(E)-2-phenylethenyl]benzene (PubChem CID 174385310) has the molecular formula C16H14FO2S-
and a molecular weight of 289.35 g/mol. Its IUPAC name is ethenesulfinate;1-fluoro-4-[(E)-2-phenylethenyl]benzene.
Molecular Properties
| Compound Name | ethenesulfinate;1-fluoro-4-[(E)-2-phenylethenyl]benzene |
| PubChem CID | 174385310 |
| Molecular Formula | C16H14FO2S- |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | ethenesulfinate;1-fluoro-4-[(E)-2-phenylethenyl]benzene |
| SMILES | C=CS(=O)[O-].Fc1ccc(/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C14H11F.C2H4O2S/c15-14-10-8-13(9-11-14)7-6-12-4-2-1-3-5-12;1-2-5(3)4/h1-11H;2H,1H2,(H,3,4)/p-1/b7-6+; |
| InChIKey | KDORZIRJPZPTBR-UHDJGPCESA-M |
| XLogP | 4.01 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze ethenesulfinate;1-fluoro-4-[(E)-2-phenylethenyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenesulfinate;1-fluoro-4-[(E)-2-phenylethenyl]benzene?
The IUPAC name of ethenesulfinate;1-fluoro-4-[(E)-2-phenylethenyl]benzene (CID 174385310) is ethenesulfinate;1-fluoro-4-[(E)-2-phenylethenyl]benzene.
What is the SMILES notation for ethenesulfinate;1-fluoro-4-[(E)-2-phenylethenyl]benzene?
The canonical SMILES for ethenesulfinate;1-fluoro-4-[(E)-2-phenylethenyl]benzene is C=CS(=O)[O-].Fc1ccc(/C=C/c2ccccc2)cc1.
What is the InChIKey of ethenesulfinate;1-fluoro-4-[(E)-2-phenylethenyl]benzene?
The InChIKey is KDORZIRJPZPTBR-UHDJGPCESA-M. The full InChI is InChI=1S/C14H11F.C2H4O2S/c15-14-10-8-13(9-11-14)7-6-12-4-2-1-3-5-12;1-2-5(3)4/h1-11H;2H,1H2,(H,3,4)/p-1/b7-6+;.
What are the key properties of ethenesulfinate;1-fluoro-4-[(E)-2-phenylethenyl]benzene?
ethenesulfinate;1-fluoro-4-[(E)-2-phenylethenyl]benzene has a molecular weight of 289.35 g/mol, XLogP of 4.01, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethenesulfinate;1-fluoro-4-[(E)-2-phenylethenyl]benzene is sourced from PubChem (CID 174385310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).