C2H7NaO3S3 — CID 174385432
sodium;1,2-bis(sulfanyl)ethanesulfonic acid;hydride (PubChem CID 174385432) has the molecular formula C2H7NaO3S3 and a molecular weight of 198.27 g/mol. Its IUPAC name is sodium;1,2-bis(sulfanyl)ethanesulfonic acid;hydride.
| Compound Name | sodium;1,2-bis(sulfanyl)ethanesulfonic acid;hydride |
|---|---|
| PubChem CID | 174385432 |
| Molecular Formula | C2H7NaO3S3 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 197.95 |
| IUPAC Name | sodium;1,2-bis(sulfanyl)ethanesulfonic acid;hydride |
| SMILES | O=S(=O)(O)C(S)CS.[H-].[Na+] |
| InChI | InChI=1S/C2H6O3S3.Na.H/c3-8(4,5)2(7)1-6;;/h2,6-7H,1H2,(H,3,4,5);;/q;+1;-1 |
| InChIKey | NTLWBMYRTJTDAC-UHFFFAOYSA-N |
| XLogP | -2.82 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | -2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|