C13H28O2 — CID 174385577
2-hydroperoxy-2-methylpropane;1,1,3-trimethylcyclohexane (PubChem CID 174385577) has the molecular formula C13H28O2 and a molecular weight of 216.36 g/mol. Its IUPAC name is 2-hydroperoxy-2-methylpropane;1,1,3-trimethylcyclohexane.
| Compound Name | 2-hydroperoxy-2-methylpropane;1,1,3-trimethylcyclohexane |
|---|---|
| PubChem CID | 174385577 |
| Molecular Formula | C13H28O2 |
| Molecular Weight | 216.36 g/mol |
| Exact Mass | 216.21 |
| IUPAC Name | 2-hydroperoxy-2-methylpropane;1,1,3-trimethylcyclohexane |
| SMILES | CC(C)(C)OO.CC1CCCC(C)(C)C1 |
| InChI | InChI=1S/C9H18.C4H10O2/c1-8-5-4-6-9(2,3)7-8;1-4(2,3)6-5/h8H,4-7H2,1-3H3;5H,1-3H3 |
| InChIKey | CAFLCCRTKLOOLE-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.36 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|