C13H18Mn — CID 174386744
manganese;2,3,4,5,6,7,8,9-octahydro-1H-fluorene (PubChem CID 174386744) has the molecular formula C13H18Mn and a molecular weight of 229.22 g/mol. Its IUPAC name is manganese;2,3,4,5,6,7,8,9-octahydro-1H-fluorene.
| Compound Name | manganese;2,3,4,5,6,7,8,9-octahydro-1H-fluorene |
|---|---|
| PubChem CID | 174386744 |
| Molecular Formula | C13H18Mn |
| Molecular Weight | 229.22 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | manganese;2,3,4,5,6,7,8,9-octahydro-1H-fluorene |
| SMILES | C1CCC2=C(C1)CC1=C2CCCC1.[Mn] |
| InChI | InChI=1S/C13H18.Mn/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;/h1-9H2; |
| InChIKey | GGYFQTGPQJCFCA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.22 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |