About formaldehyde;[4-(2-phenylethynyl)phenyl]methanamine
formaldehyde;[4-(2-phenylethynyl)phenyl]methanamine (PubChem CID 174387079) has the molecular formula C16H15NO
and a molecular weight of 237.30 g/mol. Its IUPAC name is formaldehyde;[4-(2-phenylethynyl)phenyl]methanamine.
Molecular Properties
| Compound Name | formaldehyde;[4-(2-phenylethynyl)phenyl]methanamine |
| PubChem CID | 174387079 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | formaldehyde;[4-(2-phenylethynyl)phenyl]methanamine |
| SMILES | C=O.NCc1ccc(C#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C15H13N.CH2O/c16-12-15-10-8-14(9-11-15)7-6-13-4-2-1-3-5-13;1-2/h1-5,8-11H,12,16H2;1H2 |
| InChIKey | MJRUSSOEORQIOS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;[4-(2-phenylethynyl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;[4-(2-phenylethynyl)phenyl]methanamine?
The IUPAC name of formaldehyde;[4-(2-phenylethynyl)phenyl]methanamine (CID 174387079) is formaldehyde;[4-(2-phenylethynyl)phenyl]methanamine.
What is the SMILES notation for formaldehyde;[4-(2-phenylethynyl)phenyl]methanamine?
The canonical SMILES for formaldehyde;[4-(2-phenylethynyl)phenyl]methanamine is C=O.NCc1ccc(C#Cc2ccccc2)cc1.
What is the InChIKey of formaldehyde;[4-(2-phenylethynyl)phenyl]methanamine?
The InChIKey is MJRUSSOEORQIOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N.CH2O/c16-12-15-10-8-14(9-11-15)7-6-13-4-2-1-3-5-13;1-2/h1-5,8-11H,12,16H2;1H2.
What are the key properties of formaldehyde;[4-(2-phenylethynyl)phenyl]methanamine?
formaldehyde;[4-(2-phenylethynyl)phenyl]methanamine has a molecular weight of 237.30 g/mol, XLogP of 2.36, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;[4-(2-phenylethynyl)phenyl]methanamine is sourced from PubChem (CID 174387079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).