C6H4Cl2LiNO2 — CID 174387872
lithium;2,3-dichloropyridine-4-carboxylic acid;hydride (PubChem CID 174387872) has the molecular formula C6H4Cl2LiNO2 and a molecular weight of 199.95 g/mol. Its IUPAC name is lithium;2,3-dichloropyridine-4-carboxylic acid;hydride.
| Compound Name | lithium;2,3-dichloropyridine-4-carboxylic acid;hydride |
|---|---|
| PubChem CID | 174387872 |
| Molecular Formula | C6H4Cl2LiNO2 |
| Molecular Weight | 199.95 g/mol |
| Exact Mass | 198.98 |
| IUPAC Name | lithium;2,3-dichloropyridine-4-carboxylic acid;hydride |
| SMILES | O=C(O)c1ccnc(Cl)c1Cl.[H-].[Li+] |
| InChI | InChI=1S/C6H3Cl2NO2.Li.H/c7-4-3(6(10)11)1-2-9-5(4)8;;/h1-2H,(H,10,11);;/q;+1;-1 |
| InChIKey | SDWWRHVVZIHVBH-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.95 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|