About methanesulfonic acid;4-methyl-5-methylsulfonylpentanehydrazide
methanesulfonic acid;4-methyl-5-methylsulfonylpentanehydrazide (PubChem CID 174387884) has the molecular formula C8H20N2O6S2
and a molecular weight of 304.39 g/mol. Its IUPAC name is methanesulfonic acid;4-methyl-5-methylsulfonylpentanehydrazide.
Molecular Properties
| Compound Name | methanesulfonic acid;4-methyl-5-methylsulfonylpentanehydrazide |
| PubChem CID | 174387884 |
| Molecular Formula | C8H20N2O6S2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | methanesulfonic acid;4-methyl-5-methylsulfonylpentanehydrazide |
| SMILES | CC(CCC(=O)NN)CS(C)(=O)=O.CS(=O)(=O)O |
| InChI | InChI=1S/C7H16N2O3S.CH4O3S/c1-6(5-13(2,11)12)3-4-7(10)9-8;1-5(2,3)4/h6H,3-5,8H2,1-2H3,(H,9,10);1H3,(H,2,3,4) |
| InChIKey | JYXPVNLCLKYNAM-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 143.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonic acid;4-methyl-5-methylsulfonylpentanehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonic acid;4-methyl-5-methylsulfonylpentanehydrazide?
The IUPAC name of methanesulfonic acid;4-methyl-5-methylsulfonylpentanehydrazide (CID 174387884) is methanesulfonic acid;4-methyl-5-methylsulfonylpentanehydrazide.
What is the SMILES notation for methanesulfonic acid;4-methyl-5-methylsulfonylpentanehydrazide?
The canonical SMILES for methanesulfonic acid;4-methyl-5-methylsulfonylpentanehydrazide is CC(CCC(=O)NN)CS(C)(=O)=O.CS(=O)(=O)O.
What is the InChIKey of methanesulfonic acid;4-methyl-5-methylsulfonylpentanehydrazide?
The InChIKey is JYXPVNLCLKYNAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O3S.CH4O3S/c1-6(5-13(2,11)12)3-4-7(10)9-8;1-5(2,3)4/h6H,3-5,8H2,1-2H3,(H,9,10);1H3,(H,2,3,4).
What are the key properties of methanesulfonic acid;4-methyl-5-methylsulfonylpentanehydrazide?
methanesulfonic acid;4-methyl-5-methylsulfonylpentanehydrazide has a molecular weight of 304.39 g/mol, XLogP of -1.06, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonic acid;4-methyl-5-methylsulfonylpentanehydrazide is sourced from PubChem (CID 174387884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).