About 1-aminoprop-2-ynyl formate
1-aminoprop-2-ynyl formate (PubChem CID 174388468) has the molecular formula C4H5NO2
and a molecular weight of 99.09 g/mol. Its IUPAC name is 1-aminoprop-2-ynyl formate.
Molecular Properties
| Compound Name | 1-aminoprop-2-ynyl formate |
| PubChem CID | 174388468 |
| Molecular Formula | C4H5NO2 |
| Molecular Weight | 99.09 g/mol |
| Exact Mass | 99.03 |
| IUPAC Name | 1-aminoprop-2-ynyl formate |
| SMILES | C#CC(N)OC=O |
| InChI | InChI=1S/C4H5NO2/c1-2-4(5)7-3-6/h1,3-4H,5H2 |
| InChIKey | WOIWBNVNUFKCMA-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.09 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-aminoprop-2-ynyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoprop-2-ynyl formate?
The IUPAC name of 1-aminoprop-2-ynyl formate (CID 174388468) is 1-aminoprop-2-ynyl formate.
What is the SMILES notation for 1-aminoprop-2-ynyl formate?
The canonical SMILES for 1-aminoprop-2-ynyl formate is C#CC(N)OC=O.
What is the InChIKey of 1-aminoprop-2-ynyl formate?
The InChIKey is WOIWBNVNUFKCMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2/c1-2-4(5)7-3-6/h1,3-4H,5H2.
What are the key properties of 1-aminoprop-2-ynyl formate?
1-aminoprop-2-ynyl formate has a molecular weight of 99.09 g/mol, XLogP of -0.92, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoprop-2-ynyl formate is sourced from PubChem (CID 174388468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).