C20H29ClN2O3 — CID 174389380
tert-butyl (3S)-5-amino-6-(4-chlorophenyl)-3,4-diethyl-2-imino-6-oxohexanoate (PubChem CID 174389380) has the molecular formula C20H29ClN2O3 and a molecular weight of 380.92 g/mol. Its IUPAC name is tert-butyl (3S)-5-amino-6-(4-chlorophenyl)-3,4-diethyl-2-imino-6-oxohexanoate.
| Compound Name | tert-butyl (3S)-5-amino-6-(4-chlorophenyl)-3,4-diethyl-2-imino-6-oxohexanoate |
|---|---|
| PubChem CID | 174389380 |
| Molecular Formula | C20H29ClN2O3 |
| Molecular Weight | 380.92 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | tert-butyl (3S)-5-amino-6-(4-chlorophenyl)-3,4-diethyl-2-imino-6-oxohexanoate |
| SMILES | [H]/N=C(\C(=O)OC(C)(C)C)[C@@H](CC)C(CC)C(N)C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H29ClN2O3/c1-6-14(15(7-2)17(23)19(25)26-20(3,4)5)16(22)18(24)12-8-10-13(21)11-9-12/h8-11,14-16,23H,6-7,22H2,1-5H3/b23-17-/t14?,15-,16?/m0/s1 |
| InChIKey | ZWSRRHGLVKDGMG-ZTXYJMRZSA-N |
| XLogP | 4.26 |
| TPSA | 93.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.92 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|