C19H24N2O3 — CID 174390300
methyl 2-amino-2-[3-[1-hydroxy-2-(methylamino)-3-phenylpropyl]phenyl]acetate (PubChem CID 174390300) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is methyl 2-amino-2-[3-[1-hydroxy-2-(methylamino)-3-phenylpropyl]phenyl]acetate.
| Compound Name | methyl 2-amino-2-[3-[1-hydroxy-2-(methylamino)-3-phenylpropyl]phenyl]acetate |
|---|---|
| PubChem CID | 174390300 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | methyl 2-amino-2-[3-[1-hydroxy-2-(methylamino)-3-phenylpropyl]phenyl]acetate |
| SMILES | CNC(Cc1ccccc1)C(O)c1cccc(C(N)C(=O)OC)c1 |
| InChI | InChI=1S/C19H24N2O3/c1-21-16(11-13-7-4-3-5-8-13)18(22)15-10-6-9-14(12-15)17(20)19(23)24-2/h3-10,12,16-18,21-22H,11,20H2,1-2H3 |
| InChIKey | IVNKVQUJBUZKGI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |