About 4,4-dichlorobuta-2,3-dienenitrile
4,4-dichlorobuta-2,3-dienenitrile (PubChem CID 174390702) has the molecular formula C4HCl2N
and a molecular weight of 133.97 g/mol. Its IUPAC name is 4,4-dichlorobuta-2,3-dienenitrile.
Molecular Properties
| Compound Name | 4,4-dichlorobuta-2,3-dienenitrile |
| PubChem CID | 174390702 |
| Molecular Formula | C4HCl2N |
| Molecular Weight | 133.97 g/mol |
| Exact Mass | 132.95 |
| IUPAC Name | 4,4-dichlorobuta-2,3-dienenitrile |
| SMILES | N#CC=C=C(Cl)Cl |
| InChI | InChI=1S/C4HCl2N/c5-4(6)2-1-3-7/h1H |
| InChIKey | GPFBUOYWEGMYSB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.97 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 4,4-dichlorobuta-2,3-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dichlorobuta-2,3-dienenitrile?
The IUPAC name of 4,4-dichlorobuta-2,3-dienenitrile (CID 174390702) is 4,4-dichlorobuta-2,3-dienenitrile.
What is the SMILES notation for 4,4-dichlorobuta-2,3-dienenitrile?
The canonical SMILES for 4,4-dichlorobuta-2,3-dienenitrile is N#CC=C=C(Cl)Cl.
What is the InChIKey of 4,4-dichlorobuta-2,3-dienenitrile?
The InChIKey is GPFBUOYWEGMYSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4HCl2N/c5-4(6)2-1-3-7/h1H.
What are the key properties of 4,4-dichlorobuta-2,3-dienenitrile?
4,4-dichlorobuta-2,3-dienenitrile has a molecular weight of 133.97 g/mol, XLogP of 1.98, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dichlorobuta-2,3-dienenitrile is sourced from PubChem (CID 174390702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).