About 6-ethyl-2-methyl-N-methylidene-3,3-dioxo-1,3λ6-benzoxathiole-5-carboxamide
6-ethyl-2-methyl-N-methylidene-3,3-dioxo-1,3λ6-benzoxathiole-5-carboxamide (PubChem CID 174390786) has the molecular formula C12H13NO4S
and a molecular weight of 267.31 g/mol. Its IUPAC name is 6-ethyl-2-methyl-N-methylidene-3,3-dioxo-1,3λ6-benzoxathiole-5-carboxamide.
Molecular Properties
| Compound Name | 6-ethyl-2-methyl-N-methylidene-3,3-dioxo-1,3λ6-benzoxathiole-5-carboxamide |
| PubChem CID | 174390786 |
| Molecular Formula | C12H13NO4S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | 6-ethyl-2-methyl-N-methylidene-3,3-dioxo-1,3λ6-benzoxathiole-5-carboxamide |
| SMILES | C=NC(=O)c1cc2c(cc1CC)OC(C)S2(=O)=O |
| InChI | InChI=1S/C12H13NO4S/c1-4-8-5-10-11(6-9(8)12(14)13-3)18(15,16)7(2)17-10/h5-7H,3-4H2,1-2H3 |
| InChIKey | JKOIFNLBIVZYDP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-ethyl-2-methyl-N-methylidene-3,3-dioxo-1,3λ6-benzoxathiole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-2-methyl-N-methylidene-3,3-dioxo-1,3λ6-benzoxathiole-5-carboxamide?
The IUPAC name of 6-ethyl-2-methyl-N-methylidene-3,3-dioxo-1,3λ6-benzoxathiole-5-carboxamide (CID 174390786) is 6-ethyl-2-methyl-N-methylidene-3,3-dioxo-1,3λ6-benzoxathiole-5-carboxamide.
What is the SMILES notation for 6-ethyl-2-methyl-N-methylidene-3,3-dioxo-1,3λ6-benzoxathiole-5-carboxamide?
The canonical SMILES for 6-ethyl-2-methyl-N-methylidene-3,3-dioxo-1,3λ6-benzoxathiole-5-carboxamide is C=NC(=O)c1cc2c(cc1CC)OC(C)S2(=O)=O.
What is the InChIKey of 6-ethyl-2-methyl-N-methylidene-3,3-dioxo-1,3λ6-benzoxathiole-5-carboxamide?
The InChIKey is JKOIFNLBIVZYDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO4S/c1-4-8-5-10-11(6-9(8)12(14)13-3)18(15,16)7(2)17-10/h5-7H,3-4H2,1-2H3.
What are the key properties of 6-ethyl-2-methyl-N-methylidene-3,3-dioxo-1,3λ6-benzoxathiole-5-carboxamide?
6-ethyl-2-methyl-N-methylidene-3,3-dioxo-1,3λ6-benzoxathiole-5-carboxamide has a molecular weight of 267.31 g/mol, XLogP of 1.60, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-2-methyl-N-methylidene-3,3-dioxo-1,3λ6-benzoxathiole-5-carboxamide is sourced from PubChem (CID 174390786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).