C13H13N3O2S — CID 174391043
1,3-benzothiazole;4,5-dihydro-1,3-oxazole;1,3-oxazole (PubChem CID 174391043) has the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. Its IUPAC name is 1,3-benzothiazole;4,5-dihydro-1,3-oxazole;1,3-oxazole.
| Compound Name | 1,3-benzothiazole;4,5-dihydro-1,3-oxazole;1,3-oxazole |
|---|---|
| PubChem CID | 174391043 |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 1,3-benzothiazole;4,5-dihydro-1,3-oxazole;1,3-oxazole |
| SMILES | C1=NCCO1.c1ccc2scnc2c1.c1cocn1 |
| InChI | InChI=1S/C7H5NS.C3H5NO.C3H3NO/c1-2-4-7-6(3-1)8-5-9-7;2*1-2-5-3-4-1/h1-5H;3H,1-2H2;1-3H |
| InChIKey | KYJFDYZPPYCVMK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 60.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |