About 4-fluoro-2-methylphenol;zirconium
4-fluoro-2-methylphenol;zirconium (PubChem CID 174391374) has the molecular formula C7H7FOZr
and a molecular weight of 217.35 g/mol. Its IUPAC name is 4-fluoro-2-methylphenol;zirconium.
Molecular Properties
| Compound Name | 4-fluoro-2-methylphenol;zirconium |
| PubChem CID | 174391374 |
| Molecular Formula | C7H7FOZr |
| Molecular Weight | 217.35 g/mol |
| Exact Mass | 215.95 |
| IUPAC Name | 4-fluoro-2-methylphenol;zirconium |
| SMILES | Cc1cc(F)ccc1O.[Zr] |
| InChI | InChI=1S/C7H7FO.Zr/c1-5-4-6(8)2-3-7(5)9;/h2-4,9H,1H3; |
| InChIKey | FOYYWHRJIUWYFM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-fluoro-2-methylphenol;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-2-methylphenol;zirconium?
The IUPAC name of 4-fluoro-2-methylphenol;zirconium (CID 174391374) is 4-fluoro-2-methylphenol;zirconium.
What is the SMILES notation for 4-fluoro-2-methylphenol;zirconium?
The canonical SMILES for 4-fluoro-2-methylphenol;zirconium is Cc1cc(F)ccc1O.[Zr].
What is the InChIKey of 4-fluoro-2-methylphenol;zirconium?
The InChIKey is FOYYWHRJIUWYFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7FO.Zr/c1-5-4-6(8)2-3-7(5)9;/h2-4,9H,1H3;.
What are the key properties of 4-fluoro-2-methylphenol;zirconium?
4-fluoro-2-methylphenol;zirconium has a molecular weight of 217.35 g/mol, XLogP of 1.84, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2-methylphenol;zirconium is sourced from PubChem (CID 174391374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).