C18H19FN4S2 — CID 17439186
5-(4-fluorophenyl)-4-methyl-2-[(2-thiophen-2-ylpyrrolidin-1-yl)methyl]-1,2,4-triazole-3-thione (PubChem CID 17439186) has the molecular formula C18H19FN4S2 and a molecular weight of 374.51 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-4-methyl-2-[(2-thiophen-2-ylpyrrolidin-1-yl)methyl]-1,2,4-triazole-3-thione.
| Compound Name | 5-(4-fluorophenyl)-4-methyl-2-[(2-thiophen-2-ylpyrrolidin-1-yl)methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 17439186 |
| Molecular Formula | C18H19FN4S2 |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 5-(4-fluorophenyl)-4-methyl-2-[(2-thiophen-2-ylpyrrolidin-1-yl)methyl]-1,2,4-triazole-3-thione |
| SMILES | Cn1c(-c2ccc(F)cc2)nn(CN2CCCC2c2cccs2)c1=S |
| InChI | InChI=1S/C18H19FN4S2/c1-21-17(13-6-8-14(19)9-7-13)20-23(18(21)24)12-22-10-2-4-15(22)16-5-3-11-25-16/h3,5-9,11,15H,2,4,10,12H2,1H3 |
| InChIKey | GRRVDRYXMUHYLP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 25.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|