About 2-[(4-methyl-5-phenyl-1,2-oxazol-3-yl)oxy]ethanamine;2H-triazole;hydrochloride
2-[(4-methyl-5-phenyl-1,2-oxazol-3-yl)oxy]ethanamine;2H-triazole;hydrochloride (PubChem CID 174392250) has the molecular formula C14H18ClN5O2
and a molecular weight of 323.78 g/mol. Its IUPAC name is 2-[(4-methyl-5-phenyl-1,2-oxazol-3-yl)oxy]ethanamine;2H-triazole;hydrochloride.
Molecular Properties
| Compound Name | 2-[(4-methyl-5-phenyl-1,2-oxazol-3-yl)oxy]ethanamine;2H-triazole;hydrochloride |
| PubChem CID | 174392250 |
| Molecular Formula | C14H18ClN5O2 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 2-[(4-methyl-5-phenyl-1,2-oxazol-3-yl)oxy]ethanamine;2H-triazole;hydrochloride |
| SMILES | Cc1c(OCCN)noc1-c1ccccc1.Cl.c1cn[nH]n1 |
| InChI | InChI=1S/C12H14N2O2.C2H3N3.ClH/c1-9-11(10-5-3-2-4-6-10)16-14-12(9)15-8-7-13;1-2-4-5-3-1;/h2-6H,7-8,13H2,1H3;1-2H,(H,3,4,5);1H |
| InChIKey | JNXGSPQXTIBPEH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 102.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(4-methyl-5-phenyl-1,2-oxazol-3-yl)oxy]ethanamine;2H-triazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4-methyl-5-phenyl-1,2-oxazol-3-yl)oxy]ethanamine;2H-triazole;hydrochloride?
The IUPAC name of 2-[(4-methyl-5-phenyl-1,2-oxazol-3-yl)oxy]ethanamine;2H-triazole;hydrochloride (CID 174392250) is 2-[(4-methyl-5-phenyl-1,2-oxazol-3-yl)oxy]ethanamine;2H-triazole;hydrochloride.
What is the SMILES notation for 2-[(4-methyl-5-phenyl-1,2-oxazol-3-yl)oxy]ethanamine;2H-triazole;hydrochloride?
The canonical SMILES for 2-[(4-methyl-5-phenyl-1,2-oxazol-3-yl)oxy]ethanamine;2H-triazole;hydrochloride is Cc1c(OCCN)noc1-c1ccccc1.Cl.c1cn[nH]n1.
What is the InChIKey of 2-[(4-methyl-5-phenyl-1,2-oxazol-3-yl)oxy]ethanamine;2H-triazole;hydrochloride?
The InChIKey is JNXGSPQXTIBPEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2.C2H3N3.ClH/c1-9-11(10-5-3-2-4-6-10)16-14-12(9)15-8-7-13;1-2-4-5-3-1;/h2-6H,7-8,13H2,1H3;1-2H,(H,3,4,5);1H.
What are the key properties of 2-[(4-methyl-5-phenyl-1,2-oxazol-3-yl)oxy]ethanamine;2H-triazole;hydrochloride?
2-[(4-methyl-5-phenyl-1,2-oxazol-3-yl)oxy]ethanamine;2H-triazole;hydrochloride has a molecular weight of 323.78 g/mol, XLogP of 2.21, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-methyl-5-phenyl-1,2-oxazol-3-yl)oxy]ethanamine;2H-triazole;hydrochloride is sourced from PubChem (CID 174392250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).