About diethylamino 2-acetylbut-2-enoate
diethylamino 2-acetylbut-2-enoate (PubChem CID 174392869) has the molecular formula C10H17NO3
and a molecular weight of 199.25 g/mol. Its IUPAC name is diethylamino 2-acetylbut-2-enoate.
Molecular Properties
| Compound Name | diethylamino 2-acetylbut-2-enoate |
| PubChem CID | 174392869 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | diethylamino 2-acetylbut-2-enoate |
| SMILES | CC=C(C(C)=O)C(=O)ON(CC)CC |
| InChI | InChI=1S/C10H17NO3/c1-5-9(8(4)12)10(13)14-11(6-2)7-3/h5H,6-7H2,1-4H3 |
| InChIKey | VTQDDKQZAROIMU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze diethylamino 2-acetylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethylamino 2-acetylbut-2-enoate?
The IUPAC name of diethylamino 2-acetylbut-2-enoate (CID 174392869) is diethylamino 2-acetylbut-2-enoate.
What is the SMILES notation for diethylamino 2-acetylbut-2-enoate?
The canonical SMILES for diethylamino 2-acetylbut-2-enoate is CC=C(C(C)=O)C(=O)ON(CC)CC.
What is the InChIKey of diethylamino 2-acetylbut-2-enoate?
The InChIKey is VTQDDKQZAROIMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO3/c1-5-9(8(4)12)10(13)14-11(6-2)7-3/h5H,6-7H2,1-4H3.
What are the key properties of diethylamino 2-acetylbut-2-enoate?
diethylamino 2-acetylbut-2-enoate has a molecular weight of 199.25 g/mol, XLogP of 1.32, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethylamino 2-acetylbut-2-enoate is sourced from PubChem (CID 174392869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).