C13H12ClNO2 — CID 17439317
azetidin-1-yl-(7-chloro-3-methyl-1-benzofuran-2-yl)methanone (PubChem CID 17439317) has the molecular formula C13H12ClNO2 and a molecular weight of 249.70 g/mol. Its IUPAC name is azetidin-1-yl-(7-chloro-3-methyl-1-benzofuran-2-yl)methanone.
| Compound Name | azetidin-1-yl-(7-chloro-3-methyl-1-benzofuran-2-yl)methanone |
|---|---|
| PubChem CID | 17439317 |
| Molecular Formula | C13H12ClNO2 |
| Molecular Weight | 249.70 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | azetidin-1-yl-(7-chloro-3-methyl-1-benzofuran-2-yl)methanone |
| SMILES | Cc1c(C(=O)N2CCC2)oc2c(Cl)cccc12 |
| InChI | InChI=1S/C13H12ClNO2/c1-8-9-4-2-5-10(14)12(9)17-11(8)13(16)15-6-3-7-15/h2,4-5H,3,6-7H2,1H3 |
| InChIKey | YRXBMUDFQZQWAV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.70 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |