About imidazolidine-2,2-diamine
imidazolidine-2,2-diamine (PubChem CID 174393612) has the molecular formula C3H10N4
and a molecular weight of 102.14 g/mol. Its IUPAC name is imidazolidine-2,2-diamine.
Molecular Properties
| Compound Name | imidazolidine-2,2-diamine |
| PubChem CID | 174393612 |
| Molecular Formula | C3H10N4 |
| Molecular Weight | 102.14 g/mol |
| Exact Mass | 102.09 |
| IUPAC Name | imidazolidine-2,2-diamine |
| SMILES | NC1(N)NCCN1 |
| InChI | InChI=1S/C3H10N4/c4-3(5)6-1-2-7-3/h6-7H,1-2,4-5H2 |
| InChIKey | JTVCARUUZARVDQ-UHFFFAOYSA-N |
| XLogP | -2.29 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.14 |
| LogP ≤ 5 | -2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze imidazolidine-2,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazolidine-2,2-diamine?
The IUPAC name of imidazolidine-2,2-diamine (CID 174393612) is imidazolidine-2,2-diamine.
What is the SMILES notation for imidazolidine-2,2-diamine?
The canonical SMILES for imidazolidine-2,2-diamine is NC1(N)NCCN1.
What is the InChIKey of imidazolidine-2,2-diamine?
The InChIKey is JTVCARUUZARVDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10N4/c4-3(5)6-1-2-7-3/h6-7H,1-2,4-5H2.
What are the key properties of imidazolidine-2,2-diamine?
imidazolidine-2,2-diamine has a molecular weight of 102.14 g/mol, XLogP of -2.29, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for imidazolidine-2,2-diamine is sourced from PubChem (CID 174393612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).