C15H22O6 — CID 174393695
hexan-1-ol;2-methyl-7-oxabicyclo[4.1.0]hepta-2,4-diene-1,5-dicarboxylic acid (PubChem CID 174393695) has the molecular formula C15H22O6 and a molecular weight of 298.34 g/mol. Its IUPAC name is hexan-1-ol;2-methyl-7-oxabicyclo[4.1.0]hepta-2,4-diene-1,5-dicarboxylic acid.
| Compound Name | hexan-1-ol;2-methyl-7-oxabicyclo[4.1.0]hepta-2,4-diene-1,5-dicarboxylic acid |
|---|---|
| PubChem CID | 174393695 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | hexan-1-ol;2-methyl-7-oxabicyclo[4.1.0]hepta-2,4-diene-1,5-dicarboxylic acid |
| SMILES | CC1=CC=C(C(=O)O)C2OC12C(=O)O.CCCCCCO |
| InChI | InChI=1S/C9H8O5.C6H14O/c1-4-2-3-5(7(10)11)6-9(4,14-6)8(12)13;1-2-3-4-5-6-7/h2-3,6H,1H3,(H,10,11)(H,12,13);7H,2-6H2,1H3 |
| InChIKey | ZFRGLVIQSAXDBX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 107.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|