About N,N-dimethylmethanamine;tetrachlorogermane
N,N-dimethylmethanamine;tetrachlorogermane (PubChem CID 174393904) has the molecular formula C3H9Cl4GeN
and a molecular weight of 273.53 g/mol. Its IUPAC name is N,N-dimethylmethanamine;tetrachlorogermane.
Molecular Properties
| Compound Name | N,N-dimethylmethanamine;tetrachlorogermane |
| PubChem CID | 174393904 |
| Molecular Formula | C3H9Cl4GeN |
| Molecular Weight | 273.53 g/mol |
| Exact Mass | 272.87 |
| IUPAC Name | N,N-dimethylmethanamine;tetrachlorogermane |
| SMILES | CN(C)C.Cl[Ge](Cl)(Cl)Cl |
| InChI | InChI=1S/C3H9N.Cl4Ge/c1-4(2)3;1-5(2,3)4/h1-3H3; |
| InChIKey | CEDYJPUAJLHCHG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.53 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dimethylmethanamine;tetrachlorogermane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylmethanamine;tetrachlorogermane?
The IUPAC name of N,N-dimethylmethanamine;tetrachlorogermane (CID 174393904) is N,N-dimethylmethanamine;tetrachlorogermane.
What is the SMILES notation for N,N-dimethylmethanamine;tetrachlorogermane?
The canonical SMILES for N,N-dimethylmethanamine;tetrachlorogermane is CN(C)C.Cl[Ge](Cl)(Cl)Cl.
What is the InChIKey of N,N-dimethylmethanamine;tetrachlorogermane?
The InChIKey is CEDYJPUAJLHCHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.Cl4Ge/c1-4(2)3;1-5(2,3)4/h1-3H3;.
What are the key properties of N,N-dimethylmethanamine;tetrachlorogermane?
N,N-dimethylmethanamine;tetrachlorogermane has a molecular weight of 273.53 g/mol, XLogP of 2.56, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylmethanamine;tetrachlorogermane is sourced from PubChem (CID 174393904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).