C15H30O4Si — CID 174394025
1,1,2,2-tetraethoxy-3-ethylidenesilinane (PubChem CID 174394025) has the molecular formula C15H30O4Si and a molecular weight of 302.49 g/mol. Its IUPAC name is 1,1,2,2-tetraethoxy-3-ethylidenesilinane.
| Compound Name | 1,1,2,2-tetraethoxy-3-ethylidenesilinane |
|---|---|
| PubChem CID | 174394025 |
| Molecular Formula | C15H30O4Si |
| Molecular Weight | 302.49 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 1,1,2,2-tetraethoxy-3-ethylidenesilinane |
| SMILES | CC=C1CCC[Si](OCC)(OCC)C1(OCC)OCC |
| InChI | InChI=1S/C15H30O4Si/c1-6-14-12-11-13-20(18-9-4,19-10-5)15(14,16-7-2)17-8-3/h6H,7-13H2,1-5H3 |
| InChIKey | XQUYVFDJSSCOBK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|