About 3-isocyanato-1,1,2-trimethoxy-2-propylsilinane
3-isocyanato-1,1,2-trimethoxy-2-propylsilinane (PubChem CID 174394453) has the molecular formula C12H23NO4Si
and a molecular weight of 273.40 g/mol. Its IUPAC name is 3-isocyanato-1,1,2-trimethoxy-2-propylsilinane.
Molecular Properties
| Compound Name | 3-isocyanato-1,1,2-trimethoxy-2-propylsilinane |
| PubChem CID | 174394453 |
| Molecular Formula | C12H23NO4Si |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 3-isocyanato-1,1,2-trimethoxy-2-propylsilinane |
| SMILES | CCCC1(OC)C(N=C=O)CCC[Si]1(OC)OC |
| InChI | InChI=1S/C12H23NO4Si/c1-5-8-12(15-2)11(13-10-14)7-6-9-18(12,16-3)17-4/h11H,5-9H2,1-4H3 |
| InChIKey | STEJSUFXSJYKCH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 3-isocyanato-1,1,2-trimethoxy-2-propylsilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-isocyanato-1,1,2-trimethoxy-2-propylsilinane?
The IUPAC name of 3-isocyanato-1,1,2-trimethoxy-2-propylsilinane (CID 174394453) is 3-isocyanato-1,1,2-trimethoxy-2-propylsilinane.
What is the SMILES notation for 3-isocyanato-1,1,2-trimethoxy-2-propylsilinane?
The canonical SMILES for 3-isocyanato-1,1,2-trimethoxy-2-propylsilinane is CCCC1(OC)C(N=C=O)CCC[Si]1(OC)OC.
What is the InChIKey of 3-isocyanato-1,1,2-trimethoxy-2-propylsilinane?
The InChIKey is STEJSUFXSJYKCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO4Si/c1-5-8-12(15-2)11(13-10-14)7-6-9-18(12,16-3)17-4/h11H,5-9H2,1-4H3.
What are the key properties of 3-isocyanato-1,1,2-trimethoxy-2-propylsilinane?
3-isocyanato-1,1,2-trimethoxy-2-propylsilinane has a molecular weight of 273.40 g/mol, XLogP of 1.94, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-isocyanato-1,1,2-trimethoxy-2-propylsilinane is sourced from PubChem (CID 174394453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).