C27H36N2O — CID 174394805
2,4-bis(4-phenylpiperidin-1-yl)pentan-3-one (PubChem CID 174394805) has the molecular formula C27H36N2O and a molecular weight of 404.60 g/mol. Its IUPAC name is 2,4-bis(4-phenylpiperidin-1-yl)pentan-3-one.
| Compound Name | 2,4-bis(4-phenylpiperidin-1-yl)pentan-3-one |
|---|---|
| PubChem CID | 174394805 |
| Molecular Formula | C27H36N2O |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | 2,4-bis(4-phenylpiperidin-1-yl)pentan-3-one |
| SMILES | CC(C(=O)C(C)N1CCC(c2ccccc2)CC1)N1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C27H36N2O/c1-21(28-17-13-25(14-18-28)23-9-5-3-6-10-23)27(30)22(2)29-19-15-26(16-20-29)24-11-7-4-8-12-24/h3-12,21-22,25-26H,13-20H2,1-2H3 |
| InChIKey | RAKJVUUVPGYXEH-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |