C21H21N3O5S — CID 17439492
N-[(4-morpholin-4-ylsulfonylphenyl)methyl]-2-oxo-1H-quinoline-4-carboxamide (PubChem CID 17439492) has the molecular formula C21H21N3O5S and a molecular weight of 427.48 g/mol. Its IUPAC name is N-[(4-morpholin-4-ylsulfonylphenyl)methyl]-2-oxo-1H-quinoline-4-carboxamide.
| Compound Name | N-[(4-morpholin-4-ylsulfonylphenyl)methyl]-2-oxo-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 17439492 |
| Molecular Formula | C21H21N3O5S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | N-[(4-morpholin-4-ylsulfonylphenyl)methyl]-2-oxo-1H-quinoline-4-carboxamide |
| SMILES | O=C(NCc1ccc(S(=O)(=O)N2CCOCC2)cc1)c1cc(=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C21H21N3O5S/c25-20-13-18(17-3-1-2-4-19(17)23-20)21(26)22-14-15-5-7-16(8-6-15)30(27,28)24-9-11-29-12-10-24/h1-8,13H,9-12,14H2,(H,22,26)(H,23,25) |
| InChIKey | PSMZDDYCTAXIKY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |