C8H8Cl4O — CID 174395099
2,3,5,6-tetrachloro-5,6-dimethylcyclohexa-1,3-dien-1-ol (PubChem CID 174395099) has the molecular formula C8H8Cl4O and a molecular weight of 261.96 g/mol. Its IUPAC name is 2,3,5,6-tetrachloro-5,6-dimethylcyclohexa-1,3-dien-1-ol.
| Compound Name | 2,3,5,6-tetrachloro-5,6-dimethylcyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 174395099 |
| Molecular Formula | C8H8Cl4O |
| Molecular Weight | 261.96 g/mol |
| Exact Mass | 259.93 |
| IUPAC Name | 2,3,5,6-tetrachloro-5,6-dimethylcyclohexa-1,3-dien-1-ol |
| SMILES | CC1(Cl)C=C(Cl)C(Cl)=C(O)C1(C)Cl |
| InChI | InChI=1S/C8H8Cl4O/c1-7(11)3-4(9)5(10)6(13)8(7,2)12/h3,13H,1-2H3 |
| InChIKey | XNMLAZOPKIJFIW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.96 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|