C23H28O2 — CID 174395406
2,2-dimethyl-3,4,4a,12a-tetrahydro-1H-chrysene;1,3-dioxolane (PubChem CID 174395406) has the molecular formula C23H28O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is 2,2-dimethyl-3,4,4a,12a-tetrahydro-1H-chrysene;1,3-dioxolane.
| Compound Name | 2,2-dimethyl-3,4,4a,12a-tetrahydro-1H-chrysene;1,3-dioxolane |
|---|---|
| PubChem CID | 174395406 |
| Molecular Formula | C23H28O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 2,2-dimethyl-3,4,4a,12a-tetrahydro-1H-chrysene;1,3-dioxolane |
| SMILES | C1COCO1.CC1(C)CCC2c3ccc4ccccc4c3C=CC2C1 |
| InChI | InChI=1S/C20H22.C3H6O2/c1-20(2)12-11-17-15(13-20)8-10-18-16-6-4-3-5-14(16)7-9-19(17)18;1-2-5-3-4-1/h3-10,15,17H,11-13H2,1-2H3;1-3H2 |
| InChIKey | CLHBBNONYIJRTB-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |