C17H22N3O2S- — CID 174395451
5-[3-(2-methylpropyl)piperazin-1-yl]isoquinoline-1-sulfinate (PubChem CID 174395451) has the molecular formula C17H22N3O2S- and a molecular weight of 332.45 g/mol. Its IUPAC name is 5-[3-(2-methylpropyl)piperazin-1-yl]isoquinoline-1-sulfinate.
| Compound Name | 5-[3-(2-methylpropyl)piperazin-1-yl]isoquinoline-1-sulfinate |
|---|---|
| PubChem CID | 174395451 |
| Molecular Formula | C17H22N3O2S- |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 5-[3-(2-methylpropyl)piperazin-1-yl]isoquinoline-1-sulfinate |
| SMILES | CC(C)CC1CN(c2cccc3c(S(=O)[O-])nccc23)CCN1 |
| InChI | InChI=1S/C17H23N3O2S/c1-12(2)10-13-11-20(9-8-18-13)16-5-3-4-15-14(16)6-7-19-17(15)23(21)22/h3-7,12-13,18H,8-11H2,1-2H3,(H,21,22)/p-1 |
| InChIKey | NASJGYLUQVXIAX-UHFFFAOYSA-M |
| XLogP | 2.30 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|